1-[(N-Methyl-N-tritylamino)methyl]silatrane: Synthesis and structure

The reaction of 1-(methylaminomethyl)silatrane with Ph3CCl in the presence of base leads to the formation of 1-[(N-methyl-N-tritylamino)methyl]silatrane 1. Recrystallization of this silatrane from benzene/heptane (10:1) led to the formation of the solvate complex Ph3C(Me)NCH2Si(OCH2CH2)3N·C6H6, the molecular structure of which was determined by single crystal X-ray analysis.

The synthesis and structure of the α-silatranylamine 1-[(N-methyl-N-tritylamino)methyl]silatrane Ph3CN(Me)CH2Si(OCH2CH2)3N are presented.Figure optionsDownload as PowerPoint slide