High-throughput investigation of inorganic-organic hybrid compounds: Systematic study of the system CdCl2/(H2O3PCH2)2N-CH2C6H4-COOH/NaOH

High-throughput methods incorporating solvothermal reaction conditions permit the fast and systematic investigation of the system CdCl2/(H2O3PCH2)2N-CH2C6H4-COOH (H5L)/NaOH. The effect of the pH in the starting mixture was studied, leading to the formation of four new inorganic-organic compounds. Structural elucidations confirm that H5L favors the formation of layered compounds with zipper-like connection of metal phosphonate layers.